C21H32N6O2 — CID 111414178
1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine (PubChem CID 111414178) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111414178 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCN1CCN(C(C)=O)CC1)NCc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C21H32N6O2/c1-17(28)26-14-12-25(13-15-26)11-9-23-21(22-2)24-16-18-5-7-19(8-6-18)27-10-3-4-20(27)29/h5-8H,3-4,9-16H2,1-2H3,(H2,22,23,24) |
| InChIKey | LCACUWROPIFRDN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|