C18H30S2 — CID 11141445
1,4-bis(butylsulfanyl)-2,3,5,6-tetramethylbenzene (PubChem CID 11141445) has the molecular formula C18H30S2 and a molecular weight of 310.57 g/mol. Its IUPAC name is 1,4-bis(butylsulfanyl)-2,3,5,6-tetramethylbenzene.
| Compound Name | 1,4-bis(butylsulfanyl)-2,3,5,6-tetramethylbenzene |
|---|---|
| PubChem CID | 11141445 |
| Molecular Formula | C18H30S2 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1,4-bis(butylsulfanyl)-2,3,5,6-tetramethylbenzene |
| SMILES | CCCCSc1c(C)c(C)c(SCCCC)c(C)c1C |
| InChI | InChI=1S/C18H30S2/c1-7-9-11-19-17-13(3)15(5)18(16(6)14(17)4)20-12-10-8-2/h7-12H2,1-6H3 |
| InChIKey | ARBNWTPGXRITPX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|