C15H25BrN4S — CID 111415437
2-[(5-bromothiophen-2-yl)methyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine (PubChem CID 111415437) has the molecular formula C15H25BrN4S and a molecular weight of 373.36 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111415437 |
| Molecular Formula | C15H25BrN4S |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Br)s1)NCCN1CCCCC1 |
| InChI | InChI=1S/C15H25BrN4S/c1-2-17-15(19-12-13-6-7-14(16)21-13)18-8-11-20-9-4-3-5-10-20/h6-7H,2-5,8-12H2,1H3,(H2,17,18,19) |
| InChIKey | ZLCWDWBGXPSZAN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|