C18H31FIN5 — CID 111417014
1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111417014) has the molecular formula C18H31FIN5 and a molecular weight of 463.38 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111417014 |
| Molecular Formula | C18H31FIN5 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCN1CCCCC1)NCc1ccc(N(C)C)c(F)c1.I |
| InChI | InChI=1S/C18H30FN5.HI/c1-20-18(21-9-12-24-10-5-4-6-11-24)22-14-15-7-8-17(23(2)3)16(19)13-15;/h7-8,13H,4-6,9-12,14H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | XDGPWUCJEFZXEY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|