C17H22O4S — CID 11141821
[(3R,5S)-5-phenylsulfanyl-1,9-dioxaspiro[5.5]undecan-3-yl] acetate (PubChem CID 11141821) has the molecular formula C17H22O4S and a molecular weight of 322.43 g/mol. Its IUPAC name is [(3R,5S)-5-phenylsulfanyl-1,9-dioxaspiro[5.5]undecan-3-yl] acetate.
| Compound Name | [(3R,5S)-5-phenylsulfanyl-1,9-dioxaspiro[5.5]undecan-3-yl] acetate |
|---|---|
| PubChem CID | 11141821 |
| Molecular Formula | C17H22O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [(3R,5S)-5-phenylsulfanyl-1,9-dioxaspiro[5.5]undecan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1COC2(CCOCC2)[C@@H](Sc2ccccc2)C1 |
| InChI | InChI=1S/C17H22O4S/c1-13(18)21-14-11-16(22-15-5-3-2-4-6-15)17(20-12-14)7-9-19-10-8-17/h2-6,14,16H,7-12H2,1H3/t14-,16+/m1/s1 |
| InChIKey | KCAGBLIMIIHWBX-ZBFHGGJFSA-N |
| XLogP | 3.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |