About dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate
dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate (PubChem CID 11141880) has the molecular formula C20H20O4
and a molecular weight of 324.38 g/mol. Its IUPAC name is dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate |
| PubChem CID | 11141880 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H](/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20O4/c1-23-19(21)18(20(22)24-2)17(16-11-7-4-8-12-16)14-13-15-9-5-3-6-10-15/h3-14,17-18H,1-2H3/b14-13+/t17-/m0/s1 |
| InChIKey | RTUIHIVPYZLWPB-CLVCIHKQSA-N |
| XLogP | 3.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate?
The IUPAC name of dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate (CID 11141880) is dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate.
What is the SMILES notation for dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate?
The canonical SMILES for dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate is COC(=O)C(C(=O)OC)[C@@H](/C=C/c1ccccc1)c1ccccc1.
What is the InChIKey of dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate?
The InChIKey is RTUIHIVPYZLWPB-CLVCIHKQSA-N. The full InChI is InChI=1S/C20H20O4/c1-23-19(21)18(20(22)24-2)17(16-11-7-4-8-12-16)14-13-15-9-5-3-6-10-15/h3-14,17-18H,1-2H3/b14-13+/t17-/m0/s1.
What are the key properties of dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate?
dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate has a molecular weight of 324.38 g/mol, XLogP of 3.45, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[(E,1R)-1,3-diphenylprop-2-enyl]propanedioate is sourced from PubChem (CID 11141880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).