C24H38N6O — CID 111419133
1-[2-(3,5-dimethylphenoxy)ethyl]-3-ethyl-1-methyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine (PubChem CID 111419133) has the molecular formula C24H38N6O and a molecular weight of 426.61 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenoxy)ethyl]-3-ethyl-1-methyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine.
| Compound Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-3-ethyl-1-methyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111419133 |
| Molecular Formula | C24H38N6O |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-3-ethyl-1-methyl-2-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCc1nnc2n1CCCCC2)N(C)CCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C24H38N6O/c1-5-25-24(29(4)14-15-31-21-17-19(2)16-20(3)18-21)26-12-9-11-23-28-27-22-10-7-6-8-13-30(22)23/h16-18H,5-15H2,1-4H3,(H,25,26) |
| InChIKey | OJMSCQSIPBMLDS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|