C18H37NO4 — CID 11142140
(Z,2S,3S,4R,5R)-2-aminooctadec-6-ene-1,3,4,5-tetrol (PubChem CID 11142140) has the molecular formula C18H37NO4 and a molecular weight of 331.50 g/mol. Its IUPAC name is (Z,2S,3S,4R,5R)-2-aminooctadec-6-ene-1,3,4,5-tetrol.
| Compound Name | (Z,2S,3S,4R,5R)-2-aminooctadec-6-ene-1,3,4,5-tetrol |
|---|---|
| PubChem CID | 11142140 |
| Molecular Formula | C18H37NO4 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | (Z,2S,3S,4R,5R)-2-aminooctadec-6-ene-1,3,4,5-tetrol |
| SMILES | CCCCCCCCCCC/C=C\[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C18H37NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(21)18(23)17(22)15(19)14-20/h12-13,15-18,20-23H,2-11,14,19H2,1H3/b13-12-/t15-,16+,17-,18+/m0/s1 |
| InChIKey | BZLQBBKAAPYKOE-JCXWRLLDSA-N |
| XLogP | 1.87 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|