C17H35N3O2 — CID 111422240
1-[4-[(1-methylpiperidin-2-yl)methyl]piperazin-1-yl]-3-propan-2-yloxypropan-2-ol (PubChem CID 111422240) has the molecular formula C17H35N3O2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-[4-[(1-methylpiperidin-2-yl)methyl]piperazin-1-yl]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[4-[(1-methylpiperidin-2-yl)methyl]piperazin-1-yl]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 111422240 |
| Molecular Formula | C17H35N3O2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.27 |
| IUPAC Name | 1-[4-[(1-methylpiperidin-2-yl)methyl]piperazin-1-yl]-3-propan-2-yloxypropan-2-ol |
| SMILES | CC(C)OCC(O)CN1CCN(CC2CCCCN2C)CC1 |
| InChI | InChI=1S/C17H35N3O2/c1-15(2)22-14-17(21)13-20-10-8-19(9-11-20)12-16-6-4-5-7-18(16)3/h15-17,21H,4-14H2,1-3H3 |
| InChIKey | VFVYZDRQWWEWOO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |