C19H28O5 — CID 11142280
ditert-butyl (3aS)-6-methyl-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate (PubChem CID 11142280) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is ditert-butyl (3aS)-6-methyl-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate.
| Compound Name | ditert-butyl (3aS)-6-methyl-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11142280 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | ditert-butyl (3aS)-6-methyl-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
| SMILES | CC1=C2CC(C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)C[C@H]2CC1=O |
| InChI | InChI=1S/C19H28O5/c1-11-13-10-19(9-12(13)8-14(11)20,15(21)23-17(2,3)4)16(22)24-18(5,6)7/h12H,8-10H2,1-7H3/t12-/m1/s1 |
| InChIKey | ZDHBHTSSBNAVBS-GFCCVEGCSA-N |
| XLogP | 3.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|