C13H29N3O2 — CID 111422941
1-[1-(dimethylamino)-4,4-dimethylpentan-3-yl]-3-(3-hydroxypropyl)urea (PubChem CID 111422941) has the molecular formula C13H29N3O2 and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-[1-(dimethylamino)-4,4-dimethylpentan-3-yl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[1-(dimethylamino)-4,4-dimethylpentan-3-yl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 111422941 |
| Molecular Formula | C13H29N3O2 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 1-[1-(dimethylamino)-4,4-dimethylpentan-3-yl]-3-(3-hydroxypropyl)urea |
| SMILES | CN(C)CCC(NC(=O)NCCCO)C(C)(C)C |
| InChI | InChI=1S/C13H29N3O2/c1-13(2,3)11(7-9-16(4)5)15-12(18)14-8-6-10-17/h11,17H,6-10H2,1-5H3,(H2,14,15,18) |
| InChIKey | PUTMXMLVFHVKGK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|