C19H28N4O2 — CID 111423084
N-(3-cyano-1-cyclopentyl-4,5-dimethylpyrrol-2-yl)-2-[2-hydroxyethyl(prop-2-enyl)amino]acetamide (PubChem CID 111423084) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-(3-cyano-1-cyclopentyl-4,5-dimethylpyrrol-2-yl)-2-[2-hydroxyethyl(prop-2-enyl)amino]acetamide.
| Compound Name | N-(3-cyano-1-cyclopentyl-4,5-dimethylpyrrol-2-yl)-2-[2-hydroxyethyl(prop-2-enyl)amino]acetamide |
|---|---|
| PubChem CID | 111423084 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | N-(3-cyano-1-cyclopentyl-4,5-dimethylpyrrol-2-yl)-2-[2-hydroxyethyl(prop-2-enyl)amino]acetamide |
| SMILES | C=CCN(CCO)CC(=O)Nc1c(C#N)c(C)c(C)n1C1CCCC1 |
| InChI | InChI=1S/C19H28N4O2/c1-4-9-22(10-11-24)13-18(25)21-19-17(12-20)14(2)15(3)23(19)16-7-5-6-8-16/h4,16,24H,1,5-11,13H2,2-3H3,(H,21,25) |
| InChIKey | WMYDRHDWHGVPMV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|