C19H28N2O2 — CID 111423315
2-[2-hydroxyethyl(prop-2-enyl)amino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide (PubChem CID 111423315) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(prop-2-enyl)amino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide.
| Compound Name | 2-[2-hydroxyethyl(prop-2-enyl)amino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 111423315 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 2-[2-hydroxyethyl(prop-2-enyl)amino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide |
| SMILES | C=CCN(CCO)CC(=O)NC(C)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H28N2O2/c1-3-10-21(11-12-22)14-19(23)20-15(2)17-9-8-16-6-4-5-7-18(16)13-17/h3,8-9,13,15,22H,1,4-7,10-12,14H2,2H3,(H,20,23) |
| InChIKey | UUUXLOOAVHHORZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|