C18H29N3O2 — CID 111424931
4-(1-hydroxyethyl)-N-[3-[methyl(propan-2-yl)amino]phenyl]piperidine-1-carboxamide (PubChem CID 111424931) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 4-(1-hydroxyethyl)-N-[3-[methyl(propan-2-yl)amino]phenyl]piperidine-1-carboxamide.
| Compound Name | 4-(1-hydroxyethyl)-N-[3-[methyl(propan-2-yl)amino]phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 111424931 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 4-(1-hydroxyethyl)-N-[3-[methyl(propan-2-yl)amino]phenyl]piperidine-1-carboxamide |
| SMILES | CC(O)C1CCN(C(=O)Nc2cccc(N(C)C(C)C)c2)CC1 |
| InChI | InChI=1S/C18H29N3O2/c1-13(2)20(4)17-7-5-6-16(12-17)19-18(23)21-10-8-15(9-11-21)14(3)22/h5-7,12-15,22H,8-11H2,1-4H3,(H,19,23) |
| InChIKey | KEQAWZAYZCRUQK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |