C18H21N2+ — CID 11142495
7-tert-butyl-1-aza-7-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene (PubChem CID 11142495) has the molecular formula C18H21N2+ and a molecular weight of 265.38 g/mol. Its IUPAC name is 7-tert-butyl-1-aza-7-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene.
| Compound Name | 7-tert-butyl-1-aza-7-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene |
|---|---|
| PubChem CID | 11142495 |
| Molecular Formula | C18H21N2+ |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 7-tert-butyl-1-aza-7-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene |
| SMILES | CC(C)(C)[n+]1cc2c3c(c1)c1ccccc1n3CCC2 |
| InChI | InChI=1S/C18H21N2/c1-18(2,3)19-11-13-7-6-10-20-16-9-5-4-8-14(16)15(12-19)17(13)20/h4-5,8-9,11-12H,6-7,10H2,1-3H3/q+1 |
| InChIKey | ROLGVSNYSGYAOJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|