C16H18F3NO2S — CID 111425264
1-methoxy-3-[[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]methylamino]propan-2-ol (PubChem CID 111425264) has the molecular formula C16H18F3NO2S and a molecular weight of 345.39 g/mol. Its IUPAC name is 1-methoxy-3-[[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]methylamino]propan-2-ol.
| Compound Name | 1-methoxy-3-[[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 111425264 |
| Molecular Formula | C16H18F3NO2S |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 1-methoxy-3-[[5-[4-(trifluoromethyl)phenyl]thiophen-2-yl]methylamino]propan-2-ol |
| SMILES | COCC(O)CNCc1ccc(-c2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C16H18F3NO2S/c1-22-10-13(21)8-20-9-14-6-7-15(23-14)11-2-4-12(5-3-11)16(17,18)19/h2-7,13,20-21H,8-10H2,1H3 |
| InChIKey | PILATNDLUYKNKL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |