C17H22N2OS — CID 111425450
1-cyclopentyl-2-[(2-phenyl-1,3-thiazol-4-yl)methylamino]ethanol (PubChem CID 111425450) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 1-cyclopentyl-2-[(2-phenyl-1,3-thiazol-4-yl)methylamino]ethanol.
| Compound Name | 1-cyclopentyl-2-[(2-phenyl-1,3-thiazol-4-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 111425450 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-cyclopentyl-2-[(2-phenyl-1,3-thiazol-4-yl)methylamino]ethanol |
| SMILES | OC(CNCc1csc(-c2ccccc2)n1)C1CCCC1 |
| InChI | InChI=1S/C17H22N2OS/c20-16(13-6-4-5-7-13)11-18-10-15-12-21-17(19-15)14-8-2-1-3-9-14/h1-3,8-9,12-13,16,18,20H,4-7,10-11H2 |
| InChIKey | KNKLIRIHHSGPMF-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |