About 1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea
1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 111425496) has the molecular formula C7H13F3N2O3
and a molecular weight of 230.19 g/mol. Its IUPAC name is 1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea.
Molecular Properties
| Compound Name | 1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea |
| PubChem CID | 111425496 |
| Molecular Formula | C7H13F3N2O3 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | COCC(O)CNC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O3/c1-15-3-5(13)2-11-6(14)12-4-7(8,9)10/h5,13H,2-4H2,1H3,(H2,11,12,14) |
| InChIKey | FMEFCTPEDJUPKE-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea?
The IUPAC name of 1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea (CID 111425496) is 1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea.
What is the SMILES notation for 1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea?
The canonical SMILES for 1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea is COCC(O)CNC(=O)NCC(F)(F)F.
What is the InChIKey of 1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea?
The InChIKey is FMEFCTPEDJUPKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3N2O3/c1-15-3-5(13)2-11-6(14)12-4-7(8,9)10/h5,13H,2-4H2,1H3,(H2,11,12,14).
What are the key properties of 1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea?
1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea has a molecular weight of 230.19 g/mol, XLogP of -0.14, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxy-3-methoxypropyl)-3-(2,2,2-trifluoroethyl)urea is sourced from PubChem (CID 111425496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).