C16H19N3O3 — CID 111426410
N-(2-cyclopentyl-2-hydroxyethyl)-4-(1,2,4-oxadiazol-3-yl)benzamide (PubChem CID 111426410) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(2-cyclopentyl-2-hydroxyethyl)-4-(1,2,4-oxadiazol-3-yl)benzamide.
| Compound Name | N-(2-cyclopentyl-2-hydroxyethyl)-4-(1,2,4-oxadiazol-3-yl)benzamide |
|---|---|
| PubChem CID | 111426410 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-(2-cyclopentyl-2-hydroxyethyl)-4-(1,2,4-oxadiazol-3-yl)benzamide |
| SMILES | O=C(NCC(O)C1CCCC1)c1ccc(-c2ncon2)cc1 |
| InChI | InChI=1S/C16H19N3O3/c20-14(11-3-1-2-4-11)9-17-16(21)13-7-5-12(6-8-13)15-18-10-22-19-15/h5-8,10-11,14,20H,1-4,9H2,(H,17,21) |
| InChIKey | FARBXTQITYOJND-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |