C21H38O4 — CID 11142781
(4R,5S,6S)-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,4,6,10-tetramethylundec-10-en-3-one (PubChem CID 11142781) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is (4R,5S,6S)-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,4,6,10-tetramethylundec-10-en-3-one.
| Compound Name | (4R,5S,6S)-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,4,6,10-tetramethylundec-10-en-3-one |
|---|---|
| PubChem CID | 11142781 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | (4R,5S,6S)-2-[(4S)-2,2-dimethyl-1,3-dioxan-4-yl]-5-hydroxy-2,4,6,10-tetramethylundec-10-en-3-one |
| SMILES | C=C(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H]1CCOC(C)(C)O1 |
| InChI | InChI=1S/C21H38O4/c1-14(2)10-9-11-15(3)18(22)16(4)19(23)20(5,6)17-12-13-24-21(7,8)25-17/h15-18,22H,1,9-13H2,2-8H3/t15-,16+,17-,18-/m0/s1 |
| InChIKey | ZZFINDNKEUCXBD-MHORFTMASA-N |
| XLogP | 4.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|