C12H16Cl2IN3O — CID 111428460
1-(3,5-dichlorophenyl)-2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethanol;hydroiodide (PubChem CID 111428460) has the molecular formula C12H16Cl2IN3O and a molecular weight of 416.09 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethanol;hydroiodide.
| Compound Name | 1-(3,5-dichlorophenyl)-2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethanol;hydroiodide |
|---|---|
| PubChem CID | 111428460 |
| Molecular Formula | C12H16Cl2IN3O |
| Molecular Weight | 416.09 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethanol;hydroiodide |
| SMILES | I.OC(CNC1=NCCCN1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N3O.HI/c13-9-4-8(5-10(14)6-9)11(18)7-17-12-15-2-1-3-16-12;/h4-6,11,18H,1-3,7H2,(H2,15,16,17);1H |
| InChIKey | CVDUGDZYNYVXLA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.09 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|