C20H23NO2 — CID 111429801
[4-(1-hydroxyethyl)piperidin-1-yl]-(2-phenylphenyl)methanone (PubChem CID 111429801) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is [4-(1-hydroxyethyl)piperidin-1-yl]-(2-phenylphenyl)methanone.
| Compound Name | [4-(1-hydroxyethyl)piperidin-1-yl]-(2-phenylphenyl)methanone |
|---|---|
| PubChem CID | 111429801 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | [4-(1-hydroxyethyl)piperidin-1-yl]-(2-phenylphenyl)methanone |
| SMILES | CC(O)C1CCN(C(=O)c2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23NO2/c1-15(22)16-11-13-21(14-12-16)20(23)19-10-6-5-9-18(19)17-7-3-2-4-8-17/h2-10,15-16,22H,11-14H2,1H3 |
| InChIKey | MMPRPHBNJJAVKH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |