C23H31NO3 — CID 11143154
(1R,2S,4R,6R,9S,13R)-17-methoxy-6,10,10-trimethyl-3-oxa-11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-15(20),16,18-trien-12-one (PubChem CID 11143154) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is (1R,2S,4R,6R,9S,13R)-17-methoxy-6,10,10-trimethyl-3-oxa-11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-15(20),16,18-trien-12-one.
| Compound Name | (1R,2S,4R,6R,9S,13R)-17-methoxy-6,10,10-trimethyl-3-oxa-11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-15(20),16,18-trien-12-one |
|---|---|
| PubChem CID | 11143154 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (1R,2S,4R,6R,9S,13R)-17-methoxy-6,10,10-trimethyl-3-oxa-11-azapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-15(20),16,18-trien-12-one |
| SMILES | COc1ccc2c(c1)C[C@H]1C(=O)N3[C@@H](O[C@@H]4C[C@H](C)CC[C@H]4C3(C)C)[C@@H]1C2 |
| InChI | InChI=1S/C23H31NO3/c1-13-5-8-19-20(9-13)27-22-18-11-14-6-7-16(26-4)10-15(14)12-17(18)21(25)24(22)23(19,2)3/h6-7,10,13,17-20,22H,5,8-9,11-12H2,1-4H3/t13-,17-,18-,19-,20-,22+/m1/s1 |
| InChIKey | SISLQGNYGQYMBE-HAMPUNSZSA-N |
| XLogP | 3.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |