C19H21NO5S — CID 11143284
ethyl (2S)-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-phenylbutanoate (PubChem CID 11143284) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is ethyl (2S)-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-phenylbutanoate.
| Compound Name | ethyl (2S)-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 11143284 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | ethyl (2S)-2-[(4-methylphenyl)sulfonylamino]-4-oxo-4-phenylbutanoate |
| SMILES | CCOC(=O)[C@H](CC(=O)c1ccccc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H21NO5S/c1-3-25-19(22)17(13-18(21)15-7-5-4-6-8-15)20-26(23,24)16-11-9-14(2)10-12-16/h4-12,17,20H,3,13H2,1-2H3/t17-/m0/s1 |
| InChIKey | JUUHUUNJVYFTCS-KRWDZBQOSA-N |
| XLogP | 2.48 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |