C16H20N2O2 — CID 111432875
[1-(1,2-oxazol-3-ylmethyl)piperidin-4-yl]-phenylmethanol (PubChem CID 111432875) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is [1-(1,2-oxazol-3-ylmethyl)piperidin-4-yl]-phenylmethanol.
| Compound Name | [1-(1,2-oxazol-3-ylmethyl)piperidin-4-yl]-phenylmethanol |
|---|---|
| PubChem CID | 111432875 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | [1-(1,2-oxazol-3-ylmethyl)piperidin-4-yl]-phenylmethanol |
| SMILES | OC(c1ccccc1)C1CCN(Cc2ccon2)CC1 |
| InChI | InChI=1S/C16H20N2O2/c19-16(13-4-2-1-3-5-13)14-6-9-18(10-7-14)12-15-8-11-20-17-15/h1-5,8,11,14,16,19H,6-7,9-10,12H2 |
| InChIKey | PPBJVAITFRLRRI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |