C20H28N2O3S — CID 11143314
(3aS,5R,7aR)-N,N-diethyl-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,7a-hexahydroindole-5-carboxamide (PubChem CID 11143314) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is (3aS,5R,7aR)-N,N-diethyl-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,7a-hexahydroindole-5-carboxamide.
| Compound Name | (3aS,5R,7aR)-N,N-diethyl-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,7a-hexahydroindole-5-carboxamide |
|---|---|
| PubChem CID | 11143314 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (3aS,5R,7aR)-N,N-diethyl-1-(4-methylphenyl)sulfonyl-2,3,3a,4,5,7a-hexahydroindole-5-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1C=C[C@H]2[C@H](CCN2S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C20H28N2O3S/c1-4-21(5-2)20(23)17-8-11-19-16(14-17)12-13-22(19)26(24,25)18-9-6-15(3)7-10-18/h6-11,16-17,19H,4-5,12-14H2,1-3H3/t16-,17+,19+/m1/s1 |
| InChIKey | MRVWKAUCJAEYJB-AOIWGVFYSA-N |
| XLogP | 2.82 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|