About [[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid
[[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid (PubChem CID 11143347) has the molecular formula C12H16N2O6P2S
and a molecular weight of 378.28 g/mol. Its IUPAC name is [[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid.
Molecular Properties
| Compound Name | [[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid |
| PubChem CID | 11143347 |
| Molecular Formula | C12H16N2O6P2S |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | [[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Nc1ncc(CCc2ccccc2)s1)P(=O)(O)O |
| InChI | InChI=1S/C12H16N2O6P2S/c15-21(16,17)12(22(18,19)20)14-11-13-8-10(23-11)7-6-9-4-2-1-3-5-9/h1-5,8,12H,6-7H2,(H,13,14)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | MELLDVPCTBWZRP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid?
The IUPAC name of [[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid (CID 11143347) is [[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid.
What is the SMILES notation for [[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid?
The canonical SMILES for [[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid is O=P(O)(O)C(Nc1ncc(CCc2ccccc2)s1)P(=O)(O)O.
What is the InChIKey of [[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid?
The InChIKey is MELLDVPCTBWZRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O6P2S/c15-21(16,17)12(22(18,19)20)14-11-13-8-10(23-11)7-6-9-4-2-1-3-5-9/h1-5,8,12H,6-7H2,(H,13,14)(H2,15,16,17)(H2,18,19,20).
What are the key properties of [[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid?
[[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid has a molecular weight of 378.28 g/mol, XLogP of 1.98, 7 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[[5-(2-phenylethyl)-1,3-thiazol-2-yl]amino]-phosphonomethyl]phosphonic acid is sourced from PubChem (CID 11143347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).