C17H23NO4 — CID 111433556
N-(3-hydroxybutyl)-3-(propan-2-yloxymethyl)-1-benzofuran-2-carboxamide (PubChem CID 111433556) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-3-(propan-2-yloxymethyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(3-hydroxybutyl)-3-(propan-2-yloxymethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 111433556 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-(3-hydroxybutyl)-3-(propan-2-yloxymethyl)-1-benzofuran-2-carboxamide |
| SMILES | CC(O)CCNC(=O)c1oc2ccccc2c1COC(C)C |
| InChI | InChI=1S/C17H23NO4/c1-11(2)21-10-14-13-6-4-5-7-15(13)22-16(14)17(20)18-9-8-12(3)19/h4-7,11-12,19H,8-10H2,1-3H3,(H,18,20) |
| InChIKey | RTKXZSJARZPBIB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |