C21H36O4Si — CID 11143411
diethyl 3,3-dimethyl-2-(4-trimethylsilylbut-3-ynyl)cyclohexane-1,1-dicarboxylate (PubChem CID 11143411) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is diethyl 3,3-dimethyl-2-(4-trimethylsilylbut-3-ynyl)cyclohexane-1,1-dicarboxylate.
| Compound Name | diethyl 3,3-dimethyl-2-(4-trimethylsilylbut-3-ynyl)cyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11143411 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | diethyl 3,3-dimethyl-2-(4-trimethylsilylbut-3-ynyl)cyclohexane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCCC(C)(C)C1CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C21H36O4Si/c1-8-24-18(22)21(19(23)25-9-2)15-12-14-20(3,4)17(21)13-10-11-16-26(5,6)7/h17H,8-10,12-15H2,1-7H3 |
| InChIKey | PADAYPCCUDYOIY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|