C13H28N2O2 — CID 111435289
3-(5,5-dimethylhexan-2-yl)-1-ethyl-1-(2-hydroxyethyl)urea (PubChem CID 111435289) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-(5,5-dimethylhexan-2-yl)-1-ethyl-1-(2-hydroxyethyl)urea.
| Compound Name | 3-(5,5-dimethylhexan-2-yl)-1-ethyl-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 111435289 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 3-(5,5-dimethylhexan-2-yl)-1-ethyl-1-(2-hydroxyethyl)urea |
| SMILES | CCN(CCO)C(=O)NC(C)CCC(C)(C)C |
| InChI | InChI=1S/C13H28N2O2/c1-6-15(9-10-16)12(17)14-11(2)7-8-13(3,4)5/h11,16H,6-10H2,1-5H3,(H,14,17) |
| InChIKey | UYNWGRUHVWLFLA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |