C15H29N3O2 — CID 111435375
1-cyclopropyl-3-[2-(2-ethylpiperidin-1-yl)ethyl]-1-(2-hydroxyethyl)urea (PubChem CID 111435375) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-(2-ethylpiperidin-1-yl)ethyl]-1-(2-hydroxyethyl)urea.
| Compound Name | 1-cyclopropyl-3-[2-(2-ethylpiperidin-1-yl)ethyl]-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 111435375 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 1-cyclopropyl-3-[2-(2-ethylpiperidin-1-yl)ethyl]-1-(2-hydroxyethyl)urea |
| SMILES | CCC1CCCCN1CCNC(=O)N(CCO)C1CC1 |
| InChI | InChI=1S/C15H29N3O2/c1-2-13-5-3-4-9-17(13)10-8-16-15(20)18(11-12-19)14-6-7-14/h13-14,19H,2-12H2,1H3,(H,16,20) |
| InChIKey | ORMBTGGBEDEZOE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |