C12H22O10S2 — CID 11143624
[(2R)-2-[(3aR,4R,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-methylsulfonyloxyethyl] methanesulfonate (PubChem CID 11143624) has the molecular formula C12H22O10S2 and a molecular weight of 390.43 g/mol. Its IUPAC name is [(2R)-2-[(3aR,4R,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-methylsulfonyloxyethyl] methanesulfonate.
| Compound Name | [(2R)-2-[(3aR,4R,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-methylsulfonyloxyethyl] methanesulfonate |
|---|---|
| PubChem CID | 11143624 |
| Molecular Formula | C12H22O10S2 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | [(2R)-2-[(3aR,4R,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-methylsulfonyloxyethyl] methanesulfonate |
| SMILES | CO[C@@H]1O[C@H]([C@@H](COS(C)(=O)=O)OS(C)(=O)=O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H22O10S2/c1-12(2)20-9-8(19-11(17-3)10(9)21-12)7(22-24(5,15)16)6-18-23(4,13)14/h7-11H,6H2,1-5H3/t7-,8-,9-,10-,11-/m1/s1 |
| InChIKey | CBEMCDFIYCMBIZ-ISUQUUIWSA-N |
| XLogP | -0.80 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|