C17H22N2O3 — CID 111437218
N-(3-ethyl-2-hydroxypentyl)-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 111437218) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-(3-ethyl-2-hydroxypentyl)-2-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(3-ethyl-2-hydroxypentyl)-2-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 111437218 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-(3-ethyl-2-hydroxypentyl)-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | CCC(CC)C(O)CNC(=O)c1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H22N2O3/c1-3-12(4-2)15(20)10-18-16(21)14-11-22-17(19-14)13-8-6-5-7-9-13/h5-9,11-12,15,20H,3-4,10H2,1-2H3,(H,18,21) |
| InChIKey | IJABYPRSFITTHC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |