C15H12Cl4O4 — CID 11143785
(1R,2S,4S,5R,7R,8R,9R,10R,12S,13S)-9,10,12,13-tetrachloro-11,11-dimethoxyhexacyclo[6.5.0.02,7.04,12.05,10.09,13]tridecane-3,6-dione (PubChem CID 11143785) has the molecular formula C15H12Cl4O4 and a molecular weight of 398.07 g/mol. Its IUPAC name is (1R,2S,4S,5R,7R,8R,9R,10R,12S,13S)-9,10,12,13-tetrachloro-11,11-dimethoxyhexacyclo[6.5.0.02,7.04,12.05,10.09,13]tridecane-3,6-dione.
| Compound Name | (1R,2S,4S,5R,7R,8R,9R,10R,12S,13S)-9,10,12,13-tetrachloro-11,11-dimethoxyhexacyclo[6.5.0.02,7.04,12.05,10.09,13]tridecane-3,6-dione |
|---|---|
| PubChem CID | 11143785 |
| Molecular Formula | C15H12Cl4O4 |
| Molecular Weight | 398.07 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | (1R,2S,4S,5R,7R,8R,9R,10R,12S,13S)-9,10,12,13-tetrachloro-11,11-dimethoxyhexacyclo[6.5.0.02,7.04,12.05,10.09,13]tridecane-3,6-dione |
| SMILES | COC1(OC)[C@]2(Cl)[C@H]3C(=O)[C@@H]4[C@@H]5C(=O)[C@H]3[C@@]1(Cl)[C@@]1(Cl)[C@H]5[C@@H]4[C@]12Cl |
| InChI | InChI=1S/C15H12Cl4O4/c1-22-15(23-2)13(18)7-8-10(21)4-3(9(7)20)5-6(4)12(17,11(5,13)16)14(8,15)19/h3-8H,1-2H3/t3-,4+,5-,6-,7-,8+,11+,12-,13+,14-/m1/s1 |
| InChIKey | VVJDUMSRTROAHX-UHFRNGBDSA-N |
| XLogP | 1.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.07 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|