C17H26N2O2S — CID 111438060
1-[cyclopropyl-(4-methylphenyl)methyl]-3-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)urea (PubChem CID 111438060) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is 1-[cyclopropyl-(4-methylphenyl)methyl]-3-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)urea.
| Compound Name | 1-[cyclopropyl-(4-methylphenyl)methyl]-3-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)urea |
|---|---|
| PubChem CID | 111438060 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[cyclopropyl-(4-methylphenyl)methyl]-3-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)urea |
| SMILES | CSCC(C)(O)CNC(=O)NC(c1ccc(C)cc1)C1CC1 |
| InChI | InChI=1S/C17H26N2O2S/c1-12-4-6-13(7-5-12)15(14-8-9-14)19-16(20)18-10-17(2,21)11-22-3/h4-7,14-15,21H,8-11H2,1-3H3,(H2,18,19,20) |
| InChIKey | BAJUZZFCDWZRSQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |