C19H28O9 — CID 11143837
[(2R,3'aR,5R,5'R,6R,6'aR)-5'-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxy-2',2'-dimethylspiro[2,5-dihydropyran-6,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5-yl] acetate (PubChem CID 11143837) has the molecular formula C19H28O9 and a molecular weight of 400.42 g/mol. Its IUPAC name is [(2R,3'aR,5R,5'R,6R,6'aR)-5'-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxy-2',2'-dimethylspiro[2,5-dihydropyran-6,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5-yl] acetate.
| Compound Name | [(2R,3'aR,5R,5'R,6R,6'aR)-5'-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxy-2',2'-dimethylspiro[2,5-dihydropyran-6,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5-yl] acetate |
|---|---|
| PubChem CID | 11143837 |
| Molecular Formula | C19H28O9 |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [(2R,3'aR,5R,5'R,6R,6'aR)-5'-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxy-2',2'-dimethylspiro[2,5-dihydropyran-6,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5-yl] acetate |
| SMILES | CO[C@H]1C=C[C@@H](OC(C)=O)[C@@]2(O1)[C@@H]([C@@H]1COC(C)(C)O1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C19H28O9/c1-10(20)23-12-7-8-13(21-6)26-19(12)14(11-9-22-17(2,3)25-11)24-16-15(19)27-18(4,5)28-16/h7-8,11-16H,9H2,1-6H3/t11-,12+,13+,14+,15-,16+,19+/m0/s1 |
| InChIKey | FIYKKJCCXPKXCE-CIOPWYNZSA-N |
| XLogP | 1.24 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|