C12H6Br2S3 — CID 11143949
2,5-bis(4-bromothiophen-2-yl)thiophene (PubChem CID 11143949) has the molecular formula C12H6Br2S3 and a molecular weight of 406.19 g/mol. Its IUPAC name is 2,5-bis(4-bromothiophen-2-yl)thiophene.
| Compound Name | 2,5-bis(4-bromothiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 11143949 |
| Molecular Formula | C12H6Br2S3 |
| Molecular Weight | 406.19 g/mol |
| Exact Mass | 403.80 |
| IUPAC Name | 2,5-bis(4-bromothiophen-2-yl)thiophene |
| SMILES | Brc1csc(-c2ccc(-c3cc(Br)cs3)s2)c1 |
| InChI | InChI=1S/C12H6Br2S3/c13-7-3-11(15-5-7)9-1-2-10(17-9)12-4-8(14)6-16-12/h1-6H |
| InChIKey | YWDFGMRHOUBVNC-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.19 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |