About 2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol
2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol (PubChem CID 111439547) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol |
| PubChem CID | 111439547 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol |
| SMILES | Cc1cccc2c1N(CCOCCO)CC2 |
| InChI | InChI=1S/C13H19NO2/c1-11-3-2-4-12-5-6-14(13(11)12)7-9-16-10-8-15/h2-4,15H,5-10H2,1H3 |
| InChIKey | ZYWHUGKMQMUTHS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol?
The IUPAC name of 2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol (CID 111439547) is 2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol.
What is the SMILES notation for 2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol?
The canonical SMILES for 2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol is Cc1cccc2c1N(CCOCCO)CC2.
What is the InChIKey of 2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol?
The InChIKey is ZYWHUGKMQMUTHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-11-3-2-4-12-5-6-14(13(11)12)7-9-16-10-8-15/h2-4,15H,5-10H2,1H3.
What are the key properties of 2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol?
2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol has a molecular weight of 221.30 g/mol, XLogP of 1.37, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(7-methyl-2,3-dihydroindol-1-yl)ethoxy]ethanol is sourced from PubChem (CID 111439547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).