C25H32O3Si — CID 11144006
(2S,3S)-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-3-methyl-2,3-dihydropyran-6-one (PubChem CID 11144006) has the molecular formula C25H32O3Si and a molecular weight of 408.61 g/mol. Its IUPAC name is (2S,3S)-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-3-methyl-2,3-dihydropyran-6-one.
| Compound Name | (2S,3S)-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-3-methyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11144006 |
| Molecular Formula | C25H32O3Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (2S,3S)-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-3-methyl-2,3-dihydropyran-6-one |
| SMILES | C[C@H]1C=CC(=O)O[C@@H]1[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H32O3Si/c1-19-16-17-23(26)28-24(19)20(2)18-27-29(25(3,4)5,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-17,19-20,24H,18H2,1-5H3/t19-,20-,24-/m0/s1 |
| InChIKey | ZVZYVOCOOKUHTC-SKPFHBQLSA-N |
| XLogP | 4.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|