C14H15ClN2O3S — CID 111440574
1-[(2-chloro-5-nitrophenyl)methylamino]-2-thiophen-2-ylpropan-2-ol (PubChem CID 111440574) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is 1-[(2-chloro-5-nitrophenyl)methylamino]-2-thiophen-2-ylpropan-2-ol.
| Compound Name | 1-[(2-chloro-5-nitrophenyl)methylamino]-2-thiophen-2-ylpropan-2-ol |
|---|---|
| PubChem CID | 111440574 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1-[(2-chloro-5-nitrophenyl)methylamino]-2-thiophen-2-ylpropan-2-ol |
| SMILES | CC(O)(CNCc1cc([N+](=O)[O-])ccc1Cl)c1cccs1 |
| InChI | InChI=1S/C14H15ClN2O3S/c1-14(18,13-3-2-6-21-13)9-16-8-10-7-11(17(19)20)4-5-12(10)15/h2-7,16,18H,8-9H2,1H3 |
| InChIKey | XXYKITBNBJJSDJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|