C19H16Cl3NO3 — CID 11144104
2,2,2-trichloroethyl 1,8-dimethyl-15-oxa-16-azatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-16-carboxylate (PubChem CID 11144104) has the molecular formula C19H16Cl3NO3 and a molecular weight of 412.70 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 1,8-dimethyl-15-oxa-16-azatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-16-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 1,8-dimethyl-15-oxa-16-azatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-16-carboxylate |
|---|---|
| PubChem CID | 11144104 |
| Molecular Formula | C19H16Cl3NO3 |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | 2,2,2-trichloroethyl 1,8-dimethyl-15-oxa-16-azatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-16-carboxylate |
| SMILES | CC12ON(C(=O)OCC(Cl)(Cl)Cl)C(C)(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C19H16Cl3NO3/c1-17-12-7-3-5-9-14(12)18(2,15-10-6-4-8-13(15)17)26-23(17)16(24)25-11-19(20,21)22/h3-10H,11H2,1-2H3 |
| InChIKey | RIZAIOIMPVQUGS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|