C16H18ClNO3S — CID 111441401
2-(4-chloro-2-methylphenoxy)-N-(2-hydroxy-2-thiophen-3-ylethyl)propanamide (PubChem CID 111441401) has the molecular formula C16H18ClNO3S and a molecular weight of 339.84 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-(2-hydroxy-2-thiophen-3-ylethyl)propanamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-(2-hydroxy-2-thiophen-3-ylethyl)propanamide |
|---|---|
| PubChem CID | 111441401 |
| Molecular Formula | C16H18ClNO3S |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-(2-hydroxy-2-thiophen-3-ylethyl)propanamide |
| SMILES | Cc1cc(Cl)ccc1OC(C)C(=O)NCC(O)c1ccsc1 |
| InChI | InChI=1S/C16H18ClNO3S/c1-10-7-13(17)3-4-15(10)21-11(2)16(20)18-8-14(19)12-5-6-22-9-12/h3-7,9,11,14,19H,8H2,1-2H3,(H,18,20) |
| InChIKey | DYUWKDCOMYSXQR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |