C17H15NO3S — CID 111441757
1-hydroxy-N-(2-hydroxy-2-thiophen-3-ylethyl)naphthalene-2-carboxamide (PubChem CID 111441757) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is 1-hydroxy-N-(2-hydroxy-2-thiophen-3-ylethyl)naphthalene-2-carboxamide.
| Compound Name | 1-hydroxy-N-(2-hydroxy-2-thiophen-3-ylethyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 111441757 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 1-hydroxy-N-(2-hydroxy-2-thiophen-3-ylethyl)naphthalene-2-carboxamide |
| SMILES | O=C(NCC(O)c1ccsc1)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C17H15NO3S/c19-15(12-7-8-22-10-12)9-18-17(21)14-6-5-11-3-1-2-4-13(11)16(14)20/h1-8,10,15,19-20H,9H2,(H,18,21) |
| InChIKey | WJILFAMAEWKQSX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |