C24H36O2SSi — CID 11144201
(1S,2R,4S,8R)-1-methyl-8-[(2R)-3-methyl-1-phenylsulfanylbutan-2-yl]-2-trimethylsilyloxybicyclo[2.2.2]oct-5-ene-2-carbaldehyde (PubChem CID 11144201) has the molecular formula C24H36O2SSi and a molecular weight of 416.70 g/mol. Its IUPAC name is (1S,2R,4S,8R)-1-methyl-8-[(2R)-3-methyl-1-phenylsulfanylbutan-2-yl]-2-trimethylsilyloxybicyclo[2.2.2]oct-5-ene-2-carbaldehyde.
| Compound Name | (1S,2R,4S,8R)-1-methyl-8-[(2R)-3-methyl-1-phenylsulfanylbutan-2-yl]-2-trimethylsilyloxybicyclo[2.2.2]oct-5-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 11144201 |
| Molecular Formula | C24H36O2SSi |
| Molecular Weight | 416.70 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (1S,2R,4S,8R)-1-methyl-8-[(2R)-3-methyl-1-phenylsulfanylbutan-2-yl]-2-trimethylsilyloxybicyclo[2.2.2]oct-5-ene-2-carbaldehyde |
| SMILES | CC(C)[C@@H](CSc1ccccc1)[C@@H]1C[C@@]2(C)C=C[C@@H]1C[C@@]2(C=O)O[Si](C)(C)C |
| InChI | InChI=1S/C24H36O2SSi/c1-18(2)22(16-27-20-10-8-7-9-11-20)21-15-23(3)13-12-19(21)14-24(23,17-25)26-28(4,5)6/h7-13,17-19,21-22H,14-16H2,1-6H3/t19-,21-,22-,23-,24+/m1/s1 |
| InChIKey | YQYISBKDHFDYGK-LBRNTXKHSA-N |
| XLogP | 6.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.70 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|