About tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate
tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate (PubChem CID 11144370) has the molecular formula C21H31NO6S
and a molecular weight of 425.55 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate |
| PubChem CID | 11144370 |
| Molecular Formula | C21H31NO6S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](COC1CCCCO1)C1(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H31NO6S/c1-20(2,3)28-19(23)22-17(15-27-18-11-7-8-14-26-18)21(12-13-21)29(24,25)16-9-5-4-6-10-16/h4-6,9-10,17-18H,7-8,11-15H2,1-3H3,(H,22,23)/t17-,18?/m1/s1 |
| InChIKey | PFNRZGJBKXDPIP-QNSVNVJESA-N |
| XLogP | 3.43 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate?
The IUPAC name of tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate (CID 11144370) is tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate?
The canonical SMILES for tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate is CC(C)(C)OC(=O)N[C@H](COC1CCCCO1)C1(S(=O)(=O)c2ccccc2)CC1.
What is the InChIKey of tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate?
The InChIKey is PFNRZGJBKXDPIP-QNSVNVJESA-N. The full InChI is InChI=1S/C21H31NO6S/c1-20(2,3)28-19(23)22-17(15-27-18-11-7-8-14-26-18)21(12-13-21)29(24,25)16-9-5-4-6-10-16/h4-6,9-10,17-18H,7-8,11-15H2,1-3H3,(H,22,23)/t17-,18?/m1/s1.
What are the key properties of tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate?
tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate has a molecular weight of 425.55 g/mol, XLogP of 3.43, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1R)-1-[1-(benzenesulfonyl)cyclopropyl]-2-(oxan-2-yloxy)ethyl]carbamate is sourced from PubChem (CID 11144370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).