C17H24N4O2 — CID 111444790
N-(2-hydroxy-2-propylpentyl)-6-imidazol-1-ylpyridine-3-carboxamide (PubChem CID 111444790) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-(2-hydroxy-2-propylpentyl)-6-imidazol-1-ylpyridine-3-carboxamide.
| Compound Name | N-(2-hydroxy-2-propylpentyl)-6-imidazol-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 111444790 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-(2-hydroxy-2-propylpentyl)-6-imidazol-1-ylpyridine-3-carboxamide |
| SMILES | CCCC(O)(CCC)CNC(=O)c1ccc(-n2ccnc2)nc1 |
| InChI | InChI=1S/C17H24N4O2/c1-3-7-17(23,8-4-2)12-20-16(22)14-5-6-15(19-11-14)21-10-9-18-13-21/h5-6,9-11,13,23H,3-4,7-8,12H2,1-2H3,(H,20,22) |
| InChIKey | RGGQXMYSZJORHQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |