C24H16O8 — CID 11144530
(1S,2R,14R,15S)-4,25-dimethoxy-8,12,17,21-tetraoxaheptacyclo[13.11.0.02,14.03,11.05,9.018,26.020,24]hexacosa-3(11),4,6,9,18(26),19,22,24-octaene-13,16-dione (PubChem CID 11144530) has the molecular formula C24H16O8 and a molecular weight of 432.38 g/mol. Its IUPAC name is (1S,2R,14R,15S)-4,25-dimethoxy-8,12,17,21-tetraoxaheptacyclo[13.11.0.02,14.03,11.05,9.018,26.020,24]hexacosa-3(11),4,6,9,18(26),19,22,24-octaene-13,16-dione.
| Compound Name | (1S,2R,14R,15S)-4,25-dimethoxy-8,12,17,21-tetraoxaheptacyclo[13.11.0.02,14.03,11.05,9.018,26.020,24]hexacosa-3(11),4,6,9,18(26),19,22,24-octaene-13,16-dione |
|---|---|
| PubChem CID | 11144530 |
| Molecular Formula | C24H16O8 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | (1S,2R,14R,15S)-4,25-dimethoxy-8,12,17,21-tetraoxaheptacyclo[13.11.0.02,14.03,11.05,9.018,26.020,24]hexacosa-3(11),4,6,9,18(26),19,22,24-octaene-13,16-dione |
| SMILES | COc1c2c(cc3occc13)OC(=O)[C@@H]1[C@@H]3C(=O)Oc4cc5occc5c(OC)c4[C@@H]3[C@H]21 |
| InChI | InChI=1S/C24H16O8/c1-27-21-9-3-5-29-11(9)7-13-15(21)17-18-16-14(8-12-10(4-6-30-12)22(16)28-2)32-24(26)20(18)19(17)23(25)31-13/h3-8,17-20H,1-2H3/t17-,18+,19-,20+ |
| InChIKey | CCLGJTQMQHAJLX-FGYAAKKASA-N |
| XLogP | 4.15 |
| TPSA | 97.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|