C25H40O4Si — CID 11144542
(E,3R,4S,5R,7S)-10-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-7-phenylmethoxydec-8-en-1-yne-3,5-diol (PubChem CID 11144542) has the molecular formula C25H40O4Si and a molecular weight of 432.68 g/mol. Its IUPAC name is (E,3R,4S,5R,7S)-10-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-7-phenylmethoxydec-8-en-1-yne-3,5-diol.
| Compound Name | (E,3R,4S,5R,7S)-10-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-7-phenylmethoxydec-8-en-1-yne-3,5-diol |
|---|---|
| PubChem CID | 11144542 |
| Molecular Formula | C25H40O4Si |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (E,3R,4S,5R,7S)-10-[tert-butyl(dimethyl)silyl]oxy-4,8-dimethyl-7-phenylmethoxydec-8-en-1-yne-3,5-diol |
| SMILES | C#C[C@H](O)[C@@H](C)[C@H](O)C[C@H](OCc1ccccc1)/C(C)=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40O4Si/c1-9-22(26)20(3)23(27)17-24(28-18-21-13-11-10-12-14-21)19(2)15-16-29-30(7,8)25(4,5)6/h1,10-15,20,22-24,26-27H,16-18H2,2-8H3/b19-15+/t20-,22+,23-,24+/m1/s1 |
| InChIKey | AOMPTFMPVVZTFJ-ISJMCHJBSA-N |
| XLogP | 4.92 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|