C14H42Si8 — CID 11144581
1,1,2,2,3,3,5,5,6,6,7,7,8,8-tetradecamethyl-1,2,3,4,5,6,7,8-octasilaspiro[3.4]octane (PubChem CID 11144581) has the molecular formula C14H42Si8 and a molecular weight of 435.18 g/mol. Its IUPAC name is 1,1,2,2,3,3,5,5,6,6,7,7,8,8-tetradecamethyl-1,2,3,4,5,6,7,8-octasilaspiro[3.4]octane.
| Compound Name | 1,1,2,2,3,3,5,5,6,6,7,7,8,8-tetradecamethyl-1,2,3,4,5,6,7,8-octasilaspiro[3.4]octane |
|---|---|
| PubChem CID | 11144581 |
| Molecular Formula | C14H42Si8 |
| Molecular Weight | 435.18 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 1,1,2,2,3,3,5,5,6,6,7,7,8,8-tetradecamethyl-1,2,3,4,5,6,7,8-octasilaspiro[3.4]octane |
| SMILES | C[Si]1(C)[Si](C)(C)[Si](C)(C)[Si]2([Si]1(C)C)[Si](C)(C)[Si](C)(C)[Si]2(C)C |
| InChI | InChI=1S/C14H42Si8/c1-15(2)16(3,4)19(9,10)22(18(15,7)8)20(11,12)17(5,6)21(22,13)14/h1-14H3 |
| InChIKey | NJUZEPNRDRXMIW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.18 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|