C20H20Cl2N2O5 — CID 11144659
ethyl (2S,3R,4S,5S)-5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-4-nitropyrrolidine-2-carboxylate (PubChem CID 11144659) has the molecular formula C20H20Cl2N2O5 and a molecular weight of 439.30 g/mol. Its IUPAC name is ethyl (2S,3R,4S,5S)-5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-4-nitropyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,3R,4S,5S)-5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-4-nitropyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11144659 |
| Molecular Formula | C20H20Cl2N2O5 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | ethyl (2S,3R,4S,5S)-5-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-4-nitropyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1N[C@@H](c2ccc(Cl)cc2Cl)[C@@H]([N+](=O)[O-])[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O5/c1-3-29-20(25)18-16(11-4-7-13(28-2)8-5-11)19(24(26)27)17(23-18)14-9-6-12(21)10-15(14)22/h4-10,16-19,23H,3H2,1-2H3/t16-,17+,18+,19+/m1/s1 |
| InChIKey | WNXREIFWHRKXEM-XWSJACJDSA-N |
| XLogP | 4.01 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|